C16H34N2 — CID 167520832
ethane;(1S,5R)-3-pentyl-8-propyl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 167520832) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is ethane;(1S,5R)-3-pentyl-8-propyl-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | ethane;(1S,5R)-3-pentyl-8-propyl-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 167520832 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | ethane;(1S,5R)-3-pentyl-8-propyl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CC.CCCCCN1C[C@H]2CC[C@@H](C1)N2CCC |
| InChI | InChI=1S/C14H28N2.C2H6/c1-3-5-6-10-15-11-13-7-8-14(12-15)16(13)9-4-2;1-2/h13-14H,3-12H2,1-2H3;1-2H3/t13-,14+; |
| InChIKey | SUPYMKSOMXEOHS-KAECKJJSSA-N |
| XLogP | 3.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|