C22H44N2 — CID 170008963
(1S,5R)-3-(5-methylheptyl)-8-octyl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 170008963) has the molecular formula C22H44N2 and a molecular weight of 336.61 g/mol. Its IUPAC name is (1S,5R)-3-(5-methylheptyl)-8-octyl-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | (1S,5R)-3-(5-methylheptyl)-8-octyl-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 170008963 |
| Molecular Formula | C22H44N2 |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 336.35 |
| IUPAC Name | (1S,5R)-3-(5-methylheptyl)-8-octyl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CCCCCCCCN1[C@@H]2CC[C@H]1CN(CCCCC(C)CC)C2 |
| InChI | InChI=1S/C22H44N2/c1-4-6-7-8-9-11-17-24-21-14-15-22(24)19-23(18-21)16-12-10-13-20(3)5-2/h20-22H,4-19H2,1-3H3/t20?,21-,22+ |
| InChIKey | SESQGBUKHCQABT-FRIKZZABSA-N |
| XLogP | 5.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|