C30H60N2 — CID 170006831
(1S,5R)-8-(2-hexyloctyl)-3-(5-methylnonyl)-3,8-diazabicyclo[3.2.1]octane (PubChem CID 170006831) has the molecular formula C30H60N2 and a molecular weight of 448.82 g/mol. Its IUPAC name is (1S,5R)-8-(2-hexyloctyl)-3-(5-methylnonyl)-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | (1S,5R)-8-(2-hexyloctyl)-3-(5-methylnonyl)-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 170006831 |
| Molecular Formula | C30H60N2 |
| Molecular Weight | 448.82 g/mol |
| Exact Mass | 448.48 |
| IUPAC Name | (1S,5R)-8-(2-hexyloctyl)-3-(5-methylnonyl)-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CCCCCCC(CCCCCC)CN1[C@@H]2CC[C@H]1CN(CCCCC(C)CCCC)C2 |
| InChI | InChI=1S/C30H60N2/c1-5-8-11-13-19-28(20-14-12-9-6-2)24-32-29-21-22-30(32)26-31(25-29)23-16-15-18-27(4)17-10-7-3/h27-30H,5-26H2,1-4H3/t27?,29-,30+ |
| InChIKey | XNNUNVBQNCYKNA-LHWHBECUSA-N |
| XLogP | 8.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.82 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|