C34H70N2 — CID 174045184
(2S,6R)-2,6-diethyl-1-(2-heptylnonyl)-4-(2-methylnonyl)piperazine (PubChem CID 174045184) has the molecular formula C34H70N2 and a molecular weight of 506.95 g/mol. Its IUPAC name is (2S,6R)-2,6-diethyl-1-(2-heptylnonyl)-4-(2-methylnonyl)piperazine.
| Compound Name | (2S,6R)-2,6-diethyl-1-(2-heptylnonyl)-4-(2-methylnonyl)piperazine |
|---|---|
| PubChem CID | 174045184 |
| Molecular Formula | C34H70N2 |
| Molecular Weight | 506.95 g/mol |
| Exact Mass | 506.55 |
| IUPAC Name | (2S,6R)-2,6-diethyl-1-(2-heptylnonyl)-4-(2-methylnonyl)piperazine |
| SMILES | CCCCCCCC(C)CN1C[C@@H](CC)N(CC(CCCCCCC)CCCCCCC)[C@@H](CC)C1 |
| InChI | InChI=1S/C34H70N2/c1-7-12-15-18-21-24-31(6)27-35-29-33(10-4)36(34(11-5)30-35)28-32(25-22-19-16-13-8-2)26-23-20-17-14-9-3/h31-34H,7-30H2,1-6H3/t31?,33-,34+ |
| InChIKey | QVVUQZKOKFEXSD-XFFAWDAHSA-N |
| XLogP | 10.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.95 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|