C12H24N2 — CID 156795020
(1R,5S)-8-methyl-3-pentyl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 156795020) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (1R,5S)-8-methyl-3-pentyl-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-8-methyl-3-pentyl-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 156795020 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (1R,5S)-8-methyl-3-pentyl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CCCCCN1C[C@H]2CC[C@@H](C1)N2C |
| InChI | InChI=1S/C12H24N2/c1-3-4-5-8-14-9-11-6-7-12(10-14)13(11)2/h11-12H,3-10H2,1-2H3/t11-,12+ |
| InChIKey | VZTLEWAYOLFDFH-TXEJJXNPSA-N |
| XLogP | 1.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|