C12H23BrN2 — CID 79175266
3-(4-bromobutyl)-9-methyl-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 79175266) has the molecular formula C12H23BrN2 and a molecular weight of 275.23 g/mol. Its IUPAC name is 3-(4-bromobutyl)-9-methyl-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 3-(4-bromobutyl)-9-methyl-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 79175266 |
| Molecular Formula | C12H23BrN2 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-(4-bromobutyl)-9-methyl-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | CN1C2CCC1CN(CCCCBr)CC2 |
| InChI | InChI=1S/C12H23BrN2/c1-14-11-4-5-12(14)10-15(9-6-11)8-3-2-7-13/h11-12H,2-10H2,1H3 |
| InChIKey | KQKUCFOTNITJCT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|