C13H24N2O — CID 155751712
1-(2-butyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)propan-1-one (PubChem CID 155751712) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-(2-butyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)propan-1-one.
| Compound Name | 1-(2-butyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 155751712 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 1-(2-butyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)propan-1-one |
| SMILES | CCCCN1CC2CN(C(=O)CC)CC2C1 |
| InChI | InChI=1S/C13H24N2O/c1-3-5-6-14-7-11-9-15(13(16)4-2)10-12(11)8-14/h11-12H,3-10H2,1-2H3 |
| InChIKey | HEXAQOKAOABHAS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |