C12H24N2 — CID 107899411
N,3-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine (PubChem CID 107899411) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N,3-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine.
| Compound Name | N,3-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine |
|---|---|
| PubChem CID | 107899411 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N,3-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine |
| SMILES | CNC1CCN(CC=C(C)C)CC1C |
| InChI | InChI=1S/C12H24N2/c1-10(2)5-7-14-8-6-12(13-4)11(3)9-14/h5,11-13H,6-9H2,1-4H3 |
| InChIKey | CARNIIGKAOWNDP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|