C8H15FINO2 — CID 139447093
3-[(3S,4S)-3-fluoro-4-hydroxypiperidin-1-yl]propyl hypoiodite (PubChem CID 139447093) has the molecular formula C8H15FINO2 and a molecular weight of 303.12 g/mol. Its IUPAC name is 3-[(3S,4S)-3-fluoro-4-hydroxypiperidin-1-yl]propyl hypoiodite.
| Compound Name | 3-[(3S,4S)-3-fluoro-4-hydroxypiperidin-1-yl]propyl hypoiodite |
|---|---|
| PubChem CID | 139447093 |
| Molecular Formula | C8H15FINO2 |
| Molecular Weight | 303.12 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 3-[(3S,4S)-3-fluoro-4-hydroxypiperidin-1-yl]propyl hypoiodite |
| SMILES | O[C@H]1CCN(CCCOI)C[C@@H]1F |
| InChI | InChI=1S/C8H15FINO2/c9-7-6-11(3-1-5-13-10)4-2-8(7)12/h7-8,12H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | DXMDSQLHURYOOH-YUMQZZPRSA-N |
| XLogP | 1.15 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.12 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|