C14H15NO4S — CID 174326111
methyl 3-(4-methoxyphenyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 174326111) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is methyl 3-(4-methoxyphenyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | methyl 3-(4-methoxyphenyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 174326111 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | methyl 3-(4-methoxyphenyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COC(=O)C1C(c2ccc(OC)cc2)SC2CC(=O)N21 |
| InChI | InChI=1S/C14H15NO4S/c1-18-9-5-3-8(4-6-9)13-12(14(17)19-2)15-10(16)7-11(15)20-13/h3-6,11-13H,7H2,1-2H3 |
| InChIKey | UPCPVQFCRSEDNT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |