C14H15NO5 — CID 14486426
methyl (2S,3S)-3-acetyl-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate (PubChem CID 14486426) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is methyl (2S,3S)-3-acetyl-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate.
| Compound Name | methyl (2S,3S)-3-acetyl-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 14486426 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | methyl (2S,3S)-3-acetyl-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(C)=O)C(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H15NO5/c1-8(16)11-12(14(18)20-3)15(13(11)17)9-4-6-10(19-2)7-5-9/h4-7,11-12H,1-3H3/t11-,12+/m1/s1 |
| InChIKey | LPSUKNJRIKMFHW-NEPJUHHUSA-N |
| XLogP | 0.79 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|