C15H19NO2 — CID 177457722
(3R,4S)-4-[(E)-but-2-en-2-yl]-1-(4-methoxyphenyl)-3-methylazetidin-2-one (PubChem CID 177457722) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (3R,4S)-4-[(E)-but-2-en-2-yl]-1-(4-methoxyphenyl)-3-methylazetidin-2-one.
| Compound Name | (3R,4S)-4-[(E)-but-2-en-2-yl]-1-(4-methoxyphenyl)-3-methylazetidin-2-one |
|---|---|
| PubChem CID | 177457722 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (3R,4S)-4-[(E)-but-2-en-2-yl]-1-(4-methoxyphenyl)-3-methylazetidin-2-one |
| SMILES | C/C=C(\C)[C@@H]1[C@@H](C)C(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H19NO2/c1-5-10(2)14-11(3)15(17)16(14)12-6-8-13(18-4)9-7-12/h5-9,11,14H,1-4H3/b10-5+/t11-,14-/m1/s1 |
| InChIKey | KOZOOSXKXKDFNO-CEQSHWFKSA-N |
| XLogP | 3.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|