C21H21NO2 — CID 10064561
(3R,4S)-3-ethenyl-1-(4-methoxyphenyl)-4-[(E)-1-phenylprop-1-en-2-yl]azetidin-2-one (PubChem CID 10064561) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is (3R,4S)-3-ethenyl-1-(4-methoxyphenyl)-4-[(E)-1-phenylprop-1-en-2-yl]azetidin-2-one.
| Compound Name | (3R,4S)-3-ethenyl-1-(4-methoxyphenyl)-4-[(E)-1-phenylprop-1-en-2-yl]azetidin-2-one |
|---|---|
| PubChem CID | 10064561 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (3R,4S)-3-ethenyl-1-(4-methoxyphenyl)-4-[(E)-1-phenylprop-1-en-2-yl]azetidin-2-one |
| SMILES | C=C[C@H]1C(=O)N(c2ccc(OC)cc2)[C@@H]1/C(C)=C/c1ccccc1 |
| InChI | InChI=1S/C21H21NO2/c1-4-19-20(15(2)14-16-8-6-5-7-9-16)22(21(19)23)17-10-12-18(24-3)13-11-17/h4-14,19-20H,1H2,2-3H3/b15-14+/t19-,20-/m1/s1 |
| InChIKey | IVSJWBGSVLGYBJ-ICQOZSIZSA-N |
| XLogP | 4.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|