C18H23NO3Si — CID 10758748
(3S,4S)-3-ethenyl-4-[(1R)-1-hydroxy-3-trimethylsilylprop-2-ynyl]-1-(4-methoxyphenyl)azetidin-2-one (PubChem CID 10758748) has the molecular formula C18H23NO3Si and a molecular weight of 329.47 g/mol. Its IUPAC name is (3S,4S)-3-ethenyl-4-[(1R)-1-hydroxy-3-trimethylsilylprop-2-ynyl]-1-(4-methoxyphenyl)azetidin-2-one.
| Compound Name | (3S,4S)-3-ethenyl-4-[(1R)-1-hydroxy-3-trimethylsilylprop-2-ynyl]-1-(4-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 10758748 |
| Molecular Formula | C18H23NO3Si |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (3S,4S)-3-ethenyl-4-[(1R)-1-hydroxy-3-trimethylsilylprop-2-ynyl]-1-(4-methoxyphenyl)azetidin-2-one |
| SMILES | C=C[C@@H]1C(=O)N(c2ccc(OC)cc2)[C@@H]1[C@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C18H23NO3Si/c1-6-15-17(16(20)11-12-23(3,4)5)19(18(15)21)13-7-9-14(22-2)10-8-13/h6-10,15-17,20H,1H2,2-5H3/t15-,16+,17-/m0/s1 |
| InChIKey | DNKWCEHGEWMWCI-BBWFWOEESA-N |
| XLogP | 2.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|