C18H25NO5S — CID 54062989
1-[(2S,3S)-1-(4-methoxyphenyl)-4-oxo-3-propan-2-ylazetidin-2-yl]but-3-enyl methanesulfonate (PubChem CID 54062989) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-[(2S,3S)-1-(4-methoxyphenyl)-4-oxo-3-propan-2-ylazetidin-2-yl]but-3-enyl methanesulfonate.
| Compound Name | 1-[(2S,3S)-1-(4-methoxyphenyl)-4-oxo-3-propan-2-ylazetidin-2-yl]but-3-enyl methanesulfonate |
|---|---|
| PubChem CID | 54062989 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-[(2S,3S)-1-(4-methoxyphenyl)-4-oxo-3-propan-2-ylazetidin-2-yl]but-3-enyl methanesulfonate |
| SMILES | C=CCC(OS(C)(=O)=O)[C@@H]1[C@H](C(C)C)C(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H25NO5S/c1-6-7-15(24-25(5,21)22)17-16(12(2)3)18(20)19(17)13-8-10-14(23-4)11-9-13/h6,8-12,15-17H,1,7H2,2-5H3/t15?,16-,17+/m0/s1 |
| InChIKey | MBASGQPZSLZORE-LRUHZDSUSA-N |
| XLogP | 2.60 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|