C17H25NO5 — CID 14207077
(3R,4R)-4-(diethoxymethyl)-3-[(1S)-1-hydroxyethyl]-1-(4-methoxyphenyl)azetidin-2-one (PubChem CID 14207077) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is (3R,4R)-4-(diethoxymethyl)-3-[(1S)-1-hydroxyethyl]-1-(4-methoxyphenyl)azetidin-2-one.
| Compound Name | (3R,4R)-4-(diethoxymethyl)-3-[(1S)-1-hydroxyethyl]-1-(4-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 14207077 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (3R,4R)-4-(diethoxymethyl)-3-[(1S)-1-hydroxyethyl]-1-(4-methoxyphenyl)azetidin-2-one |
| SMILES | CCOC(OCC)[C@H]1[C@H]([C@H](C)O)C(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H25NO5/c1-5-22-17(23-6-2)15-14(11(3)19)16(20)18(15)12-7-9-13(21-4)10-8-12/h7-11,14-15,17,19H,5-6H2,1-4H3/t11-,14-,15+/m0/s1 |
| InChIKey | CSLQNBLBPJOTLU-TUKIKUTGSA-N |
| XLogP | 1.81 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|