C17H26NO6P — CID 13456103
(3S,4R)-4-diethoxyphosphoryl-3-[(1R)-1-hydroxyethyl]-1-[(4-methoxyphenyl)methyl]azetidin-2-one (PubChem CID 13456103) has the molecular formula C17H26NO6P and a molecular weight of 371.37 g/mol. Its IUPAC name is (3S,4R)-4-diethoxyphosphoryl-3-[(1R)-1-hydroxyethyl]-1-[(4-methoxyphenyl)methyl]azetidin-2-one.
| Compound Name | (3S,4R)-4-diethoxyphosphoryl-3-[(1R)-1-hydroxyethyl]-1-[(4-methoxyphenyl)methyl]azetidin-2-one |
|---|---|
| PubChem CID | 13456103 |
| Molecular Formula | C17H26NO6P |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (3S,4R)-4-diethoxyphosphoryl-3-[(1R)-1-hydroxyethyl]-1-[(4-methoxyphenyl)methyl]azetidin-2-one |
| SMILES | CCOP(=O)(OCC)[C@@H]1[C@@H]([C@@H](C)O)C(=O)N1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H26NO6P/c1-5-23-25(21,24-6-2)17-15(12(3)19)16(20)18(17)11-13-7-9-14(22-4)10-8-13/h7-10,12,15,17,19H,5-6,11H2,1-4H3/t12-,15+,17-/m1/s1 |
| InChIKey | FGPWZYHMGRKCEF-ISTRZQFTSA-N |
| XLogP | 2.63 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|