C16H24NO5P — CID 87324494
3-diethoxyphosphoryl-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 87324494) has the molecular formula C16H24NO5P and a molecular weight of 341.34 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 3-diethoxyphosphoryl-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 87324494 |
| Molecular Formula | C16H24NO5P |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-diethoxyphosphoryl-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | CCOP(=O)(OCC)C1CCN(Cc2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C16H24NO5P/c1-4-21-23(19,22-5-2)15-10-11-17(16(15)18)12-13-6-8-14(20-3)9-7-13/h6-9,15H,4-5,10-12H2,1-3H3 |
| InChIKey | AVFSXQOEAJOEIN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|