C19H25NO3Si — CID 10736177
(3S,4S)-4-(1-hydroxy-3-trimethylsilylprop-2-ynyl)-1-(4-methoxyphenyl)-3-prop-2-enylazetidin-2-one (PubChem CID 10736177) has the molecular formula C19H25NO3Si and a molecular weight of 343.50 g/mol. Its IUPAC name is (3S,4S)-4-(1-hydroxy-3-trimethylsilylprop-2-ynyl)-1-(4-methoxyphenyl)-3-prop-2-enylazetidin-2-one.
| Compound Name | (3S,4S)-4-(1-hydroxy-3-trimethylsilylprop-2-ynyl)-1-(4-methoxyphenyl)-3-prop-2-enylazetidin-2-one |
|---|---|
| PubChem CID | 10736177 |
| Molecular Formula | C19H25NO3Si |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (3S,4S)-4-(1-hydroxy-3-trimethylsilylprop-2-ynyl)-1-(4-methoxyphenyl)-3-prop-2-enylazetidin-2-one |
| SMILES | C=CC[C@@H]1C(=O)N(c2ccc(OC)cc2)[C@@H]1C(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C19H25NO3Si/c1-6-7-16-18(17(21)12-13-24(3,4)5)20(19(16)22)14-8-10-15(23-2)11-9-14/h6,8-11,16-18,21H,1,7H2,2-5H3/t16-,17?,18-/m0/s1 |
| InChIKey | WODMKFHBNPNJQS-RGBJRUIASA-N |
| XLogP | 2.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|