C20H20N2O3 — CID 10871411
N-benzyl-1-[(2R,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]methanimine oxide (PubChem CID 10871411) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-benzyl-1-[(2R,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]methanimine oxide.
| Compound Name | N-benzyl-1-[(2R,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]methanimine oxide |
|---|---|
| PubChem CID | 10871411 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-benzyl-1-[(2R,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]methanimine oxide |
| SMILES | C=C[C@H]1C(=O)N(c2ccc(OC)cc2)[C@H]1/C=[N+](\[O-])Cc1ccccc1 |
| InChI | InChI=1S/C20H20N2O3/c1-3-18-19(14-21(24)13-15-7-5-4-6-8-15)22(20(18)23)16-9-11-17(25-2)12-10-16/h3-12,14,18-19H,1,13H2,2H3/b21-14-/t18-,19+/m1/s1 |
| InChIKey | SHYIUCQQJNXGHG-KNVVHKQBSA-N |
| XLogP | 2.99 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|