C19H20N2O3 — CID 15675140
(3S,4S)-1-(4-methoxyphenyl)-4-[(4-methoxyphenyl)iminomethyl]-3-methylazetidin-2-one (PubChem CID 15675140) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is (3S,4S)-1-(4-methoxyphenyl)-4-[(4-methoxyphenyl)iminomethyl]-3-methylazetidin-2-one.
| Compound Name | (3S,4S)-1-(4-methoxyphenyl)-4-[(4-methoxyphenyl)iminomethyl]-3-methylazetidin-2-one |
|---|---|
| PubChem CID | 15675140 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (3S,4S)-1-(4-methoxyphenyl)-4-[(4-methoxyphenyl)iminomethyl]-3-methylazetidin-2-one |
| SMILES | COc1ccc(/N=C/[C@@H]2[C@H](C)C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H20N2O3/c1-13-18(12-20-14-4-8-16(23-2)9-5-14)21(19(13)22)15-6-10-17(24-3)11-7-15/h4-13,18H,1-3H3/b20-12+/t13-,18+/m0/s1 |
| InChIKey | GWOWLWLRSFOGMQ-GHWXOYLCSA-N |
| XLogP | 3.46 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|