C26H25ClN2O4 — CID 92661024
(3R,4S)-3-(4-chlorophenoxy)-1-(4-ethoxyphenyl)-4-[(4-ethoxyphenyl)iminomethyl]azetidin-2-one (PubChem CID 92661024) has the molecular formula C26H25ClN2O4 and a molecular weight of 464.95 g/mol. Its IUPAC name is (3R,4S)-3-(4-chlorophenoxy)-1-(4-ethoxyphenyl)-4-[(4-ethoxyphenyl)iminomethyl]azetidin-2-one.
| Compound Name | (3R,4S)-3-(4-chlorophenoxy)-1-(4-ethoxyphenyl)-4-[(4-ethoxyphenyl)iminomethyl]azetidin-2-one |
|---|---|
| PubChem CID | 92661024 |
| Molecular Formula | C26H25ClN2O4 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | (3R,4S)-3-(4-chlorophenoxy)-1-(4-ethoxyphenyl)-4-[(4-ethoxyphenyl)iminomethyl]azetidin-2-one |
| SMILES | CCOc1ccc(/N=C/[C@H]2[C@@H](Oc3ccc(Cl)cc3)C(=O)N2c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C26H25ClN2O4/c1-3-31-21-13-7-19(8-14-21)28-17-24-25(33-23-11-5-18(27)6-12-23)26(30)29(24)20-9-15-22(16-10-20)32-4-2/h5-17,24-25H,3-4H2,1-2H3/b28-17+/t24-,25+/m0/s1 |
| InChIKey | VCPREKLMIRNCAD-CGVHKBLPSA-N |
| XLogP | 5.70 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|