C22H27NO4Si — CID 14565633
methyl (2S,3R)-3-[(1R)-1-[dimethyl(phenyl)silyl]ethyl]-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate (PubChem CID 14565633) has the molecular formula C22H27NO4Si and a molecular weight of 397.55 g/mol. Its IUPAC name is methyl (2S,3R)-3-[(1R)-1-[dimethyl(phenyl)silyl]ethyl]-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate.
| Compound Name | methyl (2S,3R)-3-[(1R)-1-[dimethyl(phenyl)silyl]ethyl]-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 14565633 |
| Molecular Formula | C22H27NO4Si |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | methyl (2S,3R)-3-[(1R)-1-[dimethyl(phenyl)silyl]ethyl]-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]([C@@H](C)[Si](C)(C)c2ccccc2)C(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H27NO4Si/c1-15(28(4,5)18-9-7-6-8-10-18)19-20(22(25)27-3)23(21(19)24)16-11-13-17(26-2)14-12-16/h6-15,19-20H,1-5H3/t15-,19-,20+/m1/s1 |
| InChIKey | BWPXACQNXITPCX-YSGRDPCXSA-N |
| XLogP | 3.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|