C13H15NO5 — CID 15349099
dimethyl (2S,3S)-1-(4-methoxyphenyl)aziridine-2,3-dicarboxylate (PubChem CID 15349099) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is dimethyl (2S,3S)-1-(4-methoxyphenyl)aziridine-2,3-dicarboxylate.
| Compound Name | dimethyl (2S,3S)-1-(4-methoxyphenyl)aziridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 15349099 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | dimethyl (2S,3S)-1-(4-methoxyphenyl)aziridine-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(=O)OC)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H15NO5/c1-17-9-6-4-8(5-7-9)14-10(12(15)18-2)11(14)13(16)19-3/h4-7,10-11H,1-3H3/t10-,11-/m0/s1 |
| InChIKey | MDNCBWWWVBAQLX-QWRGUYRKSA-N |
| XLogP | 0.60 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|