C25H23NO4 — CID 101477415
ethyl (2R,3S)-1-(4-methoxyphenyl)-3-(4-phenylbenzoyl)aziridine-2-carboxylate (PubChem CID 101477415) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is ethyl (2R,3S)-1-(4-methoxyphenyl)-3-(4-phenylbenzoyl)aziridine-2-carboxylate.
| Compound Name | ethyl (2R,3S)-1-(4-methoxyphenyl)-3-(4-phenylbenzoyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 101477415 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | ethyl (2R,3S)-1-(4-methoxyphenyl)-3-(4-phenylbenzoyl)aziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H](C(=O)c2ccc(-c3ccccc3)cc2)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H23NO4/c1-3-30-25(28)23-22(26(23)20-13-15-21(29-2)16-14-20)24(27)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-16,22-23H,3H2,1-2H3/t22-,23+,26?/m0/s1 |
| InChIKey | BLOGWDRGTLENLH-MXKXXCEUSA-N |
| XLogP | 4.37 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|