C48H50N2O10 — CID 73212305
tetraethyl 6,12-bis(4-methoxyphenyl)-3,9-diphenyl-3,9-diazapentacyclo[6.4.0.02,7.04,11.05,10]dodecane-1,5,7,11-tetracarboxylate (PubChem CID 73212305) has the molecular formula C48H50N2O10 and a molecular weight of 814.93 g/mol. Its IUPAC name is tetraethyl 6,12-bis(4-methoxyphenyl)-3,9-diphenyl-3,9-diazapentacyclo[6.4.0.02,7.04,11.05,10]dodecane-1,5,7,11-tetracarboxylate.
| Compound Name | tetraethyl 6,12-bis(4-methoxyphenyl)-3,9-diphenyl-3,9-diazapentacyclo[6.4.0.02,7.04,11.05,10]dodecane-1,5,7,11-tetracarboxylate |
|---|---|
| PubChem CID | 73212305 |
| Molecular Formula | C48H50N2O10 |
| Molecular Weight | 814.93 g/mol |
| Exact Mass | 814.35 |
| IUPAC Name | tetraethyl 6,12-bis(4-methoxyphenyl)-3,9-diphenyl-3,9-diazapentacyclo[6.4.0.02,7.04,11.05,10]dodecane-1,5,7,11-tetracarboxylate |
| SMILES | CCOC(=O)C12C(c3ccc(OC)cc3)C3(C(=O)OCC)C4N(c5ccccc5)C1C1(C(=O)OCC)C(c5ccc(OC)cc5)C4(C(=O)OCC)C3N(c3ccccc3)C21 |
| InChI | InChI=1S/C48H50N2O10/c1-7-57-41(51)45-35(29-21-25-33(55-5)26-22-29)46(42(52)58-8-2)39-48(44(54)60-10-4)36(30-23-27-34(56-6)28-24-30)47(43(53)59-9-3,37(45)49(39)31-17-13-11-14-18-31)38(45)50(40(46)48)32-19-15-12-16-20-32/h11-28,35-40H,7-10H2,1-6H3 |
| InChIKey | UODPPPWZXXJMFZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.93 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|