C18H19NO3 — CID 11033818
ethyl (2R,3R)-1-(4-methoxyphenyl)-3-phenylaziridine-2-carboxylate (PubChem CID 11033818) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is ethyl (2R,3R)-1-(4-methoxyphenyl)-3-phenylaziridine-2-carboxylate.
| Compound Name | ethyl (2R,3R)-1-(4-methoxyphenyl)-3-phenylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 11033818 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | ethyl (2R,3R)-1-(4-methoxyphenyl)-3-phenylaziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H](c2ccccc2)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H19NO3/c1-3-22-18(20)17-16(13-7-5-4-6-8-13)19(17)14-9-11-15(21-2)12-10-14/h4-12,16-17H,3H2,1-2H3/t16-,17-,19?/m1/s1 |
| InChIKey | XKXRDJRLWIZYQJ-QNZPCDNOSA-N |
| XLogP | 3.19 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|