C22H28N2O8 — CID 53466796
diethyl (2R,3S)-1-[4-[(2R,3S)-2,3-bis(ethoxycarbonyl)aziridin-1-yl]phenyl]aziridine-2,3-dicarboxylate (PubChem CID 53466796) has the molecular formula C22H28N2O8 and a molecular weight of 448.47 g/mol. Its IUPAC name is diethyl (2R,3S)-1-[4-[(2R,3S)-2,3-bis(ethoxycarbonyl)aziridin-1-yl]phenyl]aziridine-2,3-dicarboxylate.
| Compound Name | diethyl (2R,3S)-1-[4-[(2R,3S)-2,3-bis(ethoxycarbonyl)aziridin-1-yl]phenyl]aziridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 53466796 |
| Molecular Formula | C22H28N2O8 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | diethyl (2R,3S)-1-[4-[(2R,3S)-2,3-bis(ethoxycarbonyl)aziridin-1-yl]phenyl]aziridine-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](C(=O)OCC)N1c1ccc(N2[C@H](C(=O)OCC)[C@@H]2C(=O)OCC)cc1 |
| InChI | InChI=1S/C22H28N2O8/c1-5-29-19(25)15-16(20(26)30-6-2)23(15)13-9-11-14(12-10-13)24-17(21(27)31-7-3)18(24)22(28)32-8-4/h9-12,15-18H,5-8H2,1-4H3/t15-,16+,17-,18+,23?,24? |
| InChIKey | HWQBQTUUCFPZKS-VABIAQQQSA-N |
| XLogP | 1.05 |
| TPSA | 111.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|