C20H20N2O3 — CID 102040068
ethyl 4-(4-methoxyphenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene-2-carboxylate (PubChem CID 102040068) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is ethyl 4-(4-methoxyphenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene-2-carboxylate.
| Compound Name | ethyl 4-(4-methoxyphenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene-2-carboxylate |
|---|---|
| PubChem CID | 102040068 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | ethyl 4-(4-methoxyphenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene-2-carboxylate |
| SMILES | CCOC(=O)C1N=C(c2ccc(OC)cc2)C2C(c3ccccc3)N12 |
| InChI | InChI=1S/C20H20N2O3/c1-3-25-20(23)19-21-16(13-9-11-15(24-2)12-10-13)18-17(22(18)19)14-7-5-4-6-8-14/h4-12,17-19H,3H2,1-2H3 |
| InChIKey | MUPZMXDZAGLERE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|