C23H19ClN2O — CID 92838338
(2R,5S,6R)-4-(4-chlorophenyl)-2-(4-methoxyphenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene (PubChem CID 92838338) has the molecular formula C23H19ClN2O and a molecular weight of 374.87 g/mol. Its IUPAC name is (2R,5S,6R)-4-(4-chlorophenyl)-2-(4-methoxyphenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene.
| Compound Name | (2R,5S,6R)-4-(4-chlorophenyl)-2-(4-methoxyphenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
|---|---|
| PubChem CID | 92838338 |
| Molecular Formula | C23H19ClN2O |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | (2R,5S,6R)-4-(4-chlorophenyl)-2-(4-methoxyphenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
| SMILES | COc1ccc([C@H]2N=C(c3ccc(Cl)cc3)[C@@H]3[C@@H](c4ccccc4)N23)cc1 |
| InChI | InChI=1S/C23H19ClN2O/c1-27-19-13-9-17(10-14-19)23-25-20(15-7-11-18(24)12-8-15)22-21(26(22)23)16-5-3-2-4-6-16/h2-14,21-23H,1H3/t21-,22-,23+,26?/m1/s1 |
| InChIKey | HMZHNFLAEYLLKZ-FOMDFCNTSA-N |
| XLogP | 5.28 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|