C23H20N2O — CID 92640895
(2R,5R,6R)-2-(2-methoxyphenyl)-4,6-diphenyl-1,3-diazabicyclo[3.1.0]hex-3-ene (PubChem CID 92640895) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is (2R,5R,6R)-2-(2-methoxyphenyl)-4,6-diphenyl-1,3-diazabicyclo[3.1.0]hex-3-ene.
| Compound Name | (2R,5R,6R)-2-(2-methoxyphenyl)-4,6-diphenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
|---|---|
| PubChem CID | 92640895 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (2R,5R,6R)-2-(2-methoxyphenyl)-4,6-diphenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
| SMILES | COc1ccccc1[C@H]1N=C(c2ccccc2)[C@H]2[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C23H20N2O/c1-26-19-15-9-8-14-18(19)23-24-20(16-10-4-2-5-11-16)22-21(25(22)23)17-12-6-3-7-13-17/h2-15,21-23H,1H3/t21-,22+,23+,25?/m1/s1 |
| InChIKey | ZYNSVKVRUBHSMG-ICIDBNQLSA-N |
| XLogP | 4.62 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|