C22H18N2 — CID 7230464
(2S,5S,6R)-2,4,6-triphenyl-1,3-diazabicyclo[3.1.0]hex-3-ene (PubChem CID 7230464) has the molecular formula C22H18N2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (2S,5S,6R)-2,4,6-triphenyl-1,3-diazabicyclo[3.1.0]hex-3-ene.
| Compound Name | (2S,5S,6R)-2,4,6-triphenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
|---|---|
| PubChem CID | 7230464 |
| Molecular Formula | C22H18N2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (2S,5S,6R)-2,4,6-triphenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
| SMILES | c1ccc(C2=N[C@@H](c3ccccc3)N3[C@H]2[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N2/c1-4-10-16(11-5-1)19-21-20(17-12-6-2-7-13-17)24(21)22(23-19)18-14-8-3-9-15-18/h1-15,20-22H/t20-,21-,22-,24?/m1/s1 |
| InChIKey | GYTWZWMAZNKVQZ-LMKQZBFKSA-N |
| XLogP | 4.61 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|