C22H16Cl2N2 — CID 98134325
(2R,5R,6S)-2,4-bis(4-chlorophenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene (PubChem CID 98134325) has the molecular formula C22H16Cl2N2 and a molecular weight of 379.29 g/mol. Its IUPAC name is (2R,5R,6S)-2,4-bis(4-chlorophenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene.
| Compound Name | (2R,5R,6S)-2,4-bis(4-chlorophenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
|---|---|
| PubChem CID | 98134325 |
| Molecular Formula | C22H16Cl2N2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (2R,5R,6S)-2,4-bis(4-chlorophenyl)-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
| SMILES | Clc1ccc(C2=N[C@H](c3ccc(Cl)cc3)N3[C@@H]2[C@@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C22H16Cl2N2/c23-17-10-6-14(7-11-17)19-21-20(15-4-2-1-3-5-15)26(21)22(25-19)16-8-12-18(24)13-9-16/h1-13,20-22H/t20-,21-,22-,26?/m0/s1 |
| InChIKey | JHQYJDJZYHYJDQ-GAUDMLSGSA-N |
| XLogP | 5.92 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|