C23H27NO4 — CID 162489868
dimethyl 1-[4-[(4-tert-butylphenyl)methyl]phenyl]aziridine-2,3-dicarboxylate (PubChem CID 162489868) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is dimethyl 1-[4-[(4-tert-butylphenyl)methyl]phenyl]aziridine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-[(4-tert-butylphenyl)methyl]phenyl]aziridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 162489868 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | dimethyl 1-[4-[(4-tert-butylphenyl)methyl]phenyl]aziridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1C(C(=O)OC)N1c1ccc(Cc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-23(2,3)17-10-6-15(7-11-17)14-16-8-12-18(13-9-16)24-19(21(25)27-4)20(24)22(26)28-5/h6-13,19-20H,14H2,1-5H3 |
| InChIKey | BCKXCZBTKGOFNB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|