About 4-[(4-tert-butylphenyl)methyl]phenol;2-methylpropane
4-[(4-tert-butylphenyl)methyl]phenol;2-methylpropane (PubChem CID 143086936) has the molecular formula C21H30O
and a molecular weight of 298.47 g/mol. Its IUPAC name is 4-[(4-tert-butylphenyl)methyl]phenol;2-methylpropane.
Molecular Properties
| Compound Name | 4-[(4-tert-butylphenyl)methyl]phenol;2-methylpropane |
| PubChem CID | 143086936 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 4-[(4-tert-butylphenyl)methyl]phenol;2-methylpropane |
| SMILES | CC(C)(C)c1ccc(Cc2ccc(O)cc2)cc1.CC(C)C |
| InChI | InChI=1S/C17H20O.C4H10/c1-17(2,3)15-8-4-13(5-9-15)12-14-6-10-16(18)11-7-14;1-4(2)3/h4-11,18H,12H2,1-3H3;4H,1-3H3 |
| InChIKey | ZMCDBJNRTKMRLC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(4-tert-butylphenyl)methyl]phenol;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-tert-butylphenyl)methyl]phenol;2-methylpropane?
The IUPAC name of 4-[(4-tert-butylphenyl)methyl]phenol;2-methylpropane (CID 143086936) is 4-[(4-tert-butylphenyl)methyl]phenol;2-methylpropane.
What is the SMILES notation for 4-[(4-tert-butylphenyl)methyl]phenol;2-methylpropane?
The canonical SMILES for 4-[(4-tert-butylphenyl)methyl]phenol;2-methylpropane is CC(C)(C)c1ccc(Cc2ccc(O)cc2)cc1.CC(C)C.
What is the InChIKey of 4-[(4-tert-butylphenyl)methyl]phenol;2-methylpropane?
The InChIKey is ZMCDBJNRTKMRLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O.C4H10/c1-17(2,3)15-8-4-13(5-9-15)12-14-6-10-16(18)11-7-14;1-4(2)3/h4-11,18H,12H2,1-3H3;4H,1-3H3.
What are the key properties of 4-[(4-tert-butylphenyl)methyl]phenol;2-methylpropane?
4-[(4-tert-butylphenyl)methyl]phenol;2-methylpropane has a molecular weight of 298.47 g/mol, XLogP of 5.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-tert-butylphenyl)methyl]phenol;2-methylpropane is sourced from PubChem (CID 143086936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).