C19H23NO8 — CID 15441546
methyl 2-[(2S)-2,3-diacetyloxypropyl]-1-(4-methoxyphenyl)-4-oxoazetidine-3-carboxylate (PubChem CID 15441546) has the molecular formula C19H23NO8 and a molecular weight of 393.39 g/mol. Its IUPAC name is methyl 2-[(2S)-2,3-diacetyloxypropyl]-1-(4-methoxyphenyl)-4-oxoazetidine-3-carboxylate.
| Compound Name | methyl 2-[(2S)-2,3-diacetyloxypropyl]-1-(4-methoxyphenyl)-4-oxoazetidine-3-carboxylate |
|---|---|
| PubChem CID | 15441546 |
| Molecular Formula | C19H23NO8 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | methyl 2-[(2S)-2,3-diacetyloxypropyl]-1-(4-methoxyphenyl)-4-oxoazetidine-3-carboxylate |
| SMILES | COC(=O)C1C(=O)N(c2ccc(OC)cc2)C1C[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C19H23NO8/c1-11(21)27-10-15(28-12(2)22)9-16-17(19(24)26-4)18(23)20(16)13-5-7-14(25-3)8-6-13/h5-8,15-17H,9-10H2,1-4H3/t15-,16?,17?/m0/s1 |
| InChIKey | HVISAZUBCZSCHJ-GTPINHCMSA-N |
| XLogP | 1.08 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|