C21H26O3 — CID 19986864
methyl 4-[4-(4-methoxyphenyl)cyclohexen-1-yl]cyclohex-3-ene-1-carboxylate (PubChem CID 19986864) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is methyl 4-[4-(4-methoxyphenyl)cyclohexen-1-yl]cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl 4-[4-(4-methoxyphenyl)cyclohexen-1-yl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 19986864 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | methyl 4-[4-(4-methoxyphenyl)cyclohexen-1-yl]cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1CC=C(C2=CCC(c3ccc(OC)cc3)CC2)CC1 |
| InChI | InChI=1S/C21H26O3/c1-23-20-13-11-18(12-14-20)16-5-3-15(4-6-16)17-7-9-19(10-8-17)21(22)24-2/h3,7,11-14,16,19H,4-6,8-10H2,1-2H3 |
| InChIKey | ALMAKKOYJBNHGQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |