C17H22O4 — CID 177244801
ethyl 4-(2,4-dimethoxyphenyl)cyclohex-3-ene-1-carboxylate (PubChem CID 177244801) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is ethyl 4-(2,4-dimethoxyphenyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 4-(2,4-dimethoxyphenyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 177244801 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | ethyl 4-(2,4-dimethoxyphenyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1CC=C(c2ccc(OC)cc2OC)CC1 |
| InChI | InChI=1S/C17H22O4/c1-4-21-17(18)13-7-5-12(6-8-13)15-10-9-14(19-2)11-16(15)20-3/h5,9-11,13H,4,6-8H2,1-3H3 |
| InChIKey | YGTQVWCTRWNUFQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |