C14H18N2O2 — CID 67445034
ethyl (1S)-4-(3-amino-2-pyridinyl)cyclohex-3-ene-1-carboxylate (PubChem CID 67445034) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is ethyl (1S)-4-(3-amino-2-pyridinyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S)-4-(3-amino-2-pyridinyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 67445034 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | ethyl (1S)-4-(3-amino-2-pyridinyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC=C(c2ncccc2N)CC1 |
| InChI | InChI=1S/C14H18N2O2/c1-2-18-14(17)11-7-5-10(6-8-11)13-12(15)4-3-9-16-13/h3-5,9,11H,2,6-8,15H2,1H3/t11-/m1/s1 |
| InChIKey | DMJDNQHMSNOISM-LLVKDONJSA-N |
| XLogP | 2.41 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |