C14H16FNO2 — CID 58485013
ethyl 4-(5-fluoro-2-pyridinyl)cyclohex-3-ene-1-carboxylate (PubChem CID 58485013) has the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. Its IUPAC name is ethyl 4-(5-fluoro-2-pyridinyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 4-(5-fluoro-2-pyridinyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 58485013 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | ethyl 4-(5-fluoro-2-pyridinyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1CC=C(c2ccc(F)cn2)CC1 |
| InChI | InChI=1S/C14H16FNO2/c1-2-18-14(17)11-5-3-10(4-6-11)13-8-7-12(15)9-16-13/h3,7-9,11H,2,4-6H2,1H3 |
| InChIKey | HSWNAXIZZKUVEY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |