C15H17FO3 — CID 129140658
ethyl 4-(5-fluoro-2-hydroxyphenyl)cyclohex-3-ene-1-carboxylate (PubChem CID 129140658) has the molecular formula C15H17FO3 and a molecular weight of 264.30 g/mol. Its IUPAC name is ethyl 4-(5-fluoro-2-hydroxyphenyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 4-(5-fluoro-2-hydroxyphenyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 129140658 |
| Molecular Formula | C15H17FO3 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | ethyl 4-(5-fluoro-2-hydroxyphenyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1CC=C(c2cc(F)ccc2O)CC1 |
| InChI | InChI=1S/C15H17FO3/c1-2-19-15(18)11-5-3-10(4-6-11)13-9-12(16)7-8-14(13)17/h3,7-9,11,17H,2,4-6H2,1H3 |
| InChIKey | GFBDXCKNGLIWKJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |