C10H16O2 — CID 175763412
ethyl (1R)-4-(trideuteriomethyl)cyclohex-3-ene-1-carboxylate (PubChem CID 175763412) has the molecular formula C10H16O2 and a molecular weight of 171.25 g/mol. Its IUPAC name is ethyl (1R)-4-(trideuteriomethyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1R)-4-(trideuteriomethyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 175763412 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 171.25 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | ethyl (1R)-4-(trideuteriomethyl)cyclohex-3-ene-1-carboxylate |
| SMILES | [2H]C([2H])([2H])C1=CC[C@H](C(=O)OCC)CC1 |
| InChI | InChI=1S/C10H16O2/c1-3-12-10(11)9-6-4-8(2)5-7-9/h4,9H,3,5-7H2,1-2H3/t9-/m0/s1/i2D3 |
| InChIKey | PZTAKMRNULTLOL-IZTXOYSKSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|