C15H27BO5 — CID 75493051
(4-ethoxycarbonylcyclohexen-1-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 75493051) has the molecular formula C15H27BO5 and a molecular weight of 298.19 g/mol. Its IUPAC name is (4-ethoxycarbonylcyclohexen-1-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | (4-ethoxycarbonylcyclohexen-1-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 75493051 |
| Molecular Formula | C15H27BO5 |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (4-ethoxycarbonylcyclohexen-1-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CCOC(=O)C1CC=C(B(O)OC(C)(C)C(C)(C)O)CC1 |
| InChI | InChI=1S/C15H27BO5/c1-6-20-13(17)11-7-9-12(10-8-11)16(19)21-15(4,5)14(2,3)18/h9,11,18-19H,6-8,10H2,1-5H3 |
| InChIKey | KOAKVGKZCZTSLT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|