C23H42O2 — CID 144537415
ethane;ethyl 4-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]cyclohex-3-ene-1-carboxylate (PubChem CID 144537415) has the molecular formula C23H42O2 and a molecular weight of 350.59 g/mol. Its IUPAC name is ethane;ethyl 4-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]cyclohex-3-ene-1-carboxylate.
| Compound Name | ethane;ethyl 4-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 144537415 |
| Molecular Formula | C23H42O2 |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.32 |
| IUPAC Name | ethane;ethyl 4-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]cyclohex-3-ene-1-carboxylate |
| SMILES | CC.CCOC(=O)C1CC=C(C(C)(C)CC/C=C(\C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H36O2.C2H6/c1-8-23-19(22)17-11-13-18(14-12-17)21(6,7)15-9-10-16(2)20(3,4)5;1-2/h10,13,17H,8-9,11-12,14-15H2,1-7H3;1-2H3/b16-10+; |
| InChIKey | RTWJMDVVMCZLLE-QFHYWFJHSA-N |
| XLogP | 7.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|