About ethyl 1-[[(E)-2,3,3-trimethylbut-1-enyl]carbamoyl]piperidine-4-carboxylate
ethyl 1-[[(E)-2,3,3-trimethylbut-1-enyl]carbamoyl]piperidine-4-carboxylate (PubChem CID 108914959) has the molecular formula C16H28N2O3
and a molecular weight of 296.41 g/mol. Its IUPAC name is ethyl 1-[[(E)-2,3,3-trimethylbut-1-enyl]carbamoyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[[(E)-2,3,3-trimethylbut-1-enyl]carbamoyl]piperidine-4-carboxylate |
| PubChem CID | 108914959 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | ethyl 1-[[(E)-2,3,3-trimethylbut-1-enyl]carbamoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)N/C=C(\C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H28N2O3/c1-6-21-14(19)13-7-9-18(10-8-13)15(20)17-11-12(2)16(3,4)5/h11,13H,6-10H2,1-5H3,(H,17,20)/b12-11+ |
| InChIKey | LISIBOMQRFEFHY-VAWYXSNFSA-N |
| XLogP | 2.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 1-[[(E)-2,3,3-trimethylbut-1-enyl]carbamoyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[[(E)-2,3,3-trimethylbut-1-enyl]carbamoyl]piperidine-4-carboxylate?
The IUPAC name of ethyl 1-[[(E)-2,3,3-trimethylbut-1-enyl]carbamoyl]piperidine-4-carboxylate (CID 108914959) is ethyl 1-[[(E)-2,3,3-trimethylbut-1-enyl]carbamoyl]piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-[[(E)-2,3,3-trimethylbut-1-enyl]carbamoyl]piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-[[(E)-2,3,3-trimethylbut-1-enyl]carbamoyl]piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)N/C=C(\C)C(C)(C)C)CC1.
What is the InChIKey of ethyl 1-[[(E)-2,3,3-trimethylbut-1-enyl]carbamoyl]piperidine-4-carboxylate?
The InChIKey is LISIBOMQRFEFHY-VAWYXSNFSA-N. The full InChI is InChI=1S/C16H28N2O3/c1-6-21-14(19)13-7-9-18(10-8-13)15(20)17-11-12(2)16(3,4)5/h11,13H,6-10H2,1-5H3,(H,17,20)/b12-11+.
What are the key properties of ethyl 1-[[(E)-2,3,3-trimethylbut-1-enyl]carbamoyl]piperidine-4-carboxylate?
ethyl 1-[[(E)-2,3,3-trimethylbut-1-enyl]carbamoyl]piperidine-4-carboxylate has a molecular weight of 296.41 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[[(E)-2,3,3-trimethylbut-1-enyl]carbamoyl]piperidine-4-carboxylate is sourced from PubChem (CID 108914959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).