C10H15F3N2O3 — CID 108865828
ethyl 1-(trifluoromethylcarbamoyl)piperidine-4-carboxylate (PubChem CID 108865828) has the molecular formula C10H15F3N2O3 and a molecular weight of 268.23 g/mol. Its IUPAC name is ethyl 1-(trifluoromethylcarbamoyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(trifluoromethylcarbamoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108865828 |
| Molecular Formula | C10H15F3N2O3 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | ethyl 1-(trifluoromethylcarbamoyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)NC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H15F3N2O3/c1-2-18-8(16)7-3-5-15(6-4-7)9(17)14-10(11,12)13/h7H,2-6H2,1H3,(H,14,17) |
| InChIKey | QCWOZDCCRVAAES-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|