C13H22ClNO3 — CID 63679178
ethyl 1-(3-chloro-2,2-dimethylpropanoyl)piperidine-4-carboxylate (PubChem CID 63679178) has the molecular formula C13H22ClNO3 and a molecular weight of 275.78 g/mol. Its IUPAC name is ethyl 1-(3-chloro-2,2-dimethylpropanoyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(3-chloro-2,2-dimethylpropanoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 63679178 |
| Molecular Formula | C13H22ClNO3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | ethyl 1-(3-chloro-2,2-dimethylpropanoyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C(C)(C)CCl)CC1 |
| InChI | InChI=1S/C13H22ClNO3/c1-4-18-11(16)10-5-7-15(8-6-10)12(17)13(2,3)9-14/h10H,4-9H2,1-3H3 |
| InChIKey | FCPXQORCAPBNBP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|