C25H34O3 — CID 19986876
pentyl 4-[4-(4-methoxyphenyl)cyclohexen-1-yl]cyclohex-3-ene-1-carboxylate (PubChem CID 19986876) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is pentyl 4-[4-(4-methoxyphenyl)cyclohexen-1-yl]cyclohex-3-ene-1-carboxylate.
| Compound Name | pentyl 4-[4-(4-methoxyphenyl)cyclohexen-1-yl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 19986876 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | pentyl 4-[4-(4-methoxyphenyl)cyclohexen-1-yl]cyclohex-3-ene-1-carboxylate |
| SMILES | CCCCCOC(=O)C1CC=C(C2=CCC(c3ccc(OC)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H34O3/c1-3-4-5-18-28-25(26)23-12-10-21(11-13-23)19-6-8-20(9-7-19)22-14-16-24(27-2)17-15-22/h6,10,14-17,20,23H,3-5,7-9,11-13,18H2,1-2H3 |
| InChIKey | GJXAJGSFFUXSOG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|