C25H28O7 — CID 99803062
ethyl (1R,6S)-4-(2,4-dimethoxyphenyl)-6-(2,5-dimethoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 99803062) has the molecular formula C25H28O7 and a molecular weight of 440.49 g/mol. Its IUPAC name is ethyl (1R,6S)-4-(2,4-dimethoxyphenyl)-6-(2,5-dimethoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,6S)-4-(2,4-dimethoxyphenyl)-6-(2,5-dimethoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 99803062 |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | ethyl (1R,6S)-4-(2,4-dimethoxyphenyl)-6-(2,5-dimethoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)C=C(c2ccc(OC)cc2OC)C[C@@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C25H28O7/c1-6-32-25(27)24-20(19-13-16(28-2)8-10-22(19)30-4)11-15(12-21(24)26)18-9-7-17(29-3)14-23(18)31-5/h7-10,12-14,20,24H,6,11H2,1-5H3/t20-,24-/m1/s1 |
| InChIKey | OUOOMVUXUAAODH-HYBUGGRVSA-N |
| XLogP | 4.04 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|