C27H26O6 — CID 151398790
ethyl 4-(2-hydroxy-4,5-dimethoxyphenyl)-6-naphthalen-2-yl-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 151398790) has the molecular formula C27H26O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is ethyl 4-(2-hydroxy-4,5-dimethoxyphenyl)-6-naphthalen-2-yl-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 4-(2-hydroxy-4,5-dimethoxyphenyl)-6-naphthalen-2-yl-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 151398790 |
| Molecular Formula | C27H26O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | ethyl 4-(2-hydroxy-4,5-dimethoxyphenyl)-6-naphthalen-2-yl-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C=C(c2cc(OC)c(OC)cc2O)CC1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H26O6/c1-4-33-27(30)26-21(18-10-9-16-7-5-6-8-17(16)11-18)12-19(13-23(26)29)20-14-24(31-2)25(32-3)15-22(20)28/h5-11,13-15,21,26,28H,4,12H2,1-3H3 |
| InChIKey | OWANYXOCIDJHMQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|